| Name |
(Z)-3-(((4-bromophenyl)amino)methylene)-1-(3-fluorobenzyl)-1H-thieno[3,2-c][1,2]thiazin-4(3H)-one 2,2-dioxide
|
| Molecular Formula |
C20H14BrFN2O3S2
|
| Molecular Weight |
493.4
|
| Smiles |
O=C1C(=CNc2ccc(Br)cc2)S(=O)(=O)N(Cc2cccc(F)c2)c2ccsc21
|
O=C1C(=CNc2ccc(Br)cc2)S(=O)(=O)N(Cc2cccc(F)c2)c2ccsc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.