| Name |
N-(5,6-dimethyl-4-oxo-4H-thieno[2,3-d][1,3]thiazin-2-yl)-4-(1,3-dioxo-1H-benzo[de]isoquinolin-2(3H)-yl)butanamide
|
| Molecular Formula |
C24H19N3O4S2
|
| Molecular Weight |
477.6
|
| Smiles |
Cc1sc2nc(NC(=O)CCCN3C(=O)c4cccc5cccc(c45)C3=O)sc(=O)c2c1C
|
Cc1sc2nc(NC(=O)CCCN3C(=O)c4cccc5cccc(c45)C3=O)sc(=O)c2c1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.