| Name |
(4R,4'R)-2,2'-(Undecane-6,6-diyl)bis(4-phenyl-4,5-dihydrooxazole)
|
| Molecular Formula |
C29H38N2O2
|
| Molecular Weight |
446.6
|
| Smiles |
CCCCCC(CCCCC)(C1=NC(c2ccccc2)CO1)C1=NC(c2ccccc2)CO1
|
CCCCCC(CCCCC)(C1=NC(c2ccccc2)CO1)C1=NC(c2ccccc2)CO1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.