| Name |
4-(2,4-dimethoxybenzyl)-7-nitro-3,4-dihydrobenzo[f][1,4]oxazepin-5(2H)-one
|
| Molecular Formula |
C18H18N2O6
|
| Molecular Weight |
358.3
|
| Smiles |
COc1ccc(CN2CCOc3ccc([N+](=O)[O-])cc3C2=O)c(OC)c1
|
COc1ccc(CN2CCOc3ccc([N+](=O)[O-])cc3C2=O)c(OC)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.