| Name |
3,4,5,6,6A,7-Hexahydro-7-hydroxy-7-(trifluoromethyl)pyrido-[4,3-C]-isoxazole
|
| Molecular Formula |
C7H9F3N2O2
|
| Molecular Weight |
210.15
|
| Smiles |
OC1(C(F)(F)F)ON=C2CCNCC21
|
OC1(C(F)(F)F)ON=C2CCNCC21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.