| Name |
5-{[5-(3-Bromophenyl)-1,3,4-oxadiazol-2-yl]methyl}-3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazole
|
| Molecular Formula |
C19H15BrN4O4
|
| Molecular Weight |
443.3
|
| Smiles |
COc1ccc(-c2noc(Cc3nnc(-c4cccc(Br)c4)o3)n2)cc1OC
|
COc1ccc(-c2noc(Cc3nnc(-c4cccc(Br)c4)o3)n2)cc1OC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.