| Name |
2-(Pyrrolidin-1-YL)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-YL)pyridine
|
| Molecular Formula |
C15H23BN2O2
|
| Molecular Weight |
274.17
|
| Smiles |
CC1(C)OB(c2cccc(N3CCCC3)n2)OC1(C)C
|
CC1(C)OB(c2cccc(N3CCCC3)n2)OC1(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.