| Name |
2-(2-Fluorophenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
|
| Molecular Formula |
C17H19BFNO2
|
| Molecular Weight |
299.1
|
| Smiles |
CC1(C)OB(c2ccnc(-c3ccccc3F)c2)OC1(C)C
|
CC1(C)OB(c2ccnc(-c3ccccc3F)c2)OC1(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.