| Name |
N-[3-(methylsulfanyl)phenyl]-2-({4-oxo-3-propyl-3H,4H-thieno[3,2-d]pyrimidin-2-yl}sulfanyl)acetamide
|
| Molecular Formula |
C18H19N3O2S3
|
| Molecular Weight |
405.6
|
| Smiles |
CCCn1c(SCC(=O)Nc2cccc(SC)c2)nc2ccsc2c1=O
|
CCCn1c(SCC(=O)Nc2cccc(SC)c2)nc2ccsc2c1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.