| Name |
2-({3-benzyl-4-oxo-3H,4H-thieno[3,2-d]pyrimidin-2-yl}sulfanyl)-N-(2-chloro-4-methylphenyl)acetamide
|
| Molecular Formula |
C22H18ClN3O2S2
|
| Molecular Weight |
456.0
|
| Smiles |
Cc1ccc(NC(=O)CSc2nc3ccsc3c(=O)n2Cc2ccccc2)c(Cl)c1
|
Cc1ccc(NC(=O)CSc2nc3ccsc3c(=O)n2Cc2ccccc2)c(Cl)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.