| Name |
N-[(2H-1,3-benzodioxol-5-yl)methyl]-3-[8-oxo-6-({[(2-phenylethyl)carbamoyl]methyl}sulfanyl)-2H,7H,8H-[1,3]dioxolo[4,5-g]quinazolin-7-yl]propanamide
|
| Molecular Formula |
C30H28N4O7S
|
| Molecular Weight |
588.6
|
| Smiles |
O=C(CCn1c(SCC(=O)NCCc2ccccc2)nc2cc3c(cc2c1=O)OCO3)NCc1ccc2c(c1)OCO2
|
O=C(CCn1c(SCC(=O)NCCc2ccccc2)nc2cc3c(cc2c1=O)OCO3)NCc1ccc2c(c1)OCO2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.