| Name |
N-(2-ethylphenyl)-2-{4-[3-(thiophen-2-yl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl}acetamide
|
| Molecular Formula |
C21H24N4O2S
|
| Molecular Weight |
396.5
|
| Smiles |
CCc1ccccc1NC(=O)CN1CCC(c2nc(-c3cccs3)no2)CC1
|
CCc1ccccc1NC(=O)CN1CCC(c2nc(-c3cccs3)no2)CC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.