| Name | 5-amino-N-(3-methoxyphenyl)-1-{[5-methyl-2-(3-methylphenyl)-1,3-oxazol-4-yl]methyl}-1H-1,2,3-triazole-4-carboxamide | 
                        
                        
                        
                    
                 
                
                
                    
                        
                        
                            | Molecular Formula | C22H22N6O3 | 
                        
                        
                            | Molecular Weight | 418.4 | 
                        
                        
                            | Smiles | COc1cccc(NC(=O)c2nnn(Cc3nc(-c4cccc(C)c4)oc3C)c2N)c1 | 
                        
                        
                    
                 
                
                
                
                
                
                
                
                    
                        COc1cccc(NC(=O)c2nnn(Cc3nc(-c4cccc(C)c4)oc3C)c2N)c1
                    
                 
                
                
                The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.