| Name |
1-((3-(benzo[d][1,3]dioxol-5-yl)-1,2,4-oxadiazol-5-yl)methyl)-4-(4-chlorobenzyl)pyrazine-2,3(1H,4H)-dione
|
| Molecular Formula |
C21H15ClN4O5
|
| Molecular Weight |
438.8
|
| Smiles |
O=c1c(=O)n(Cc2nc(-c3ccc4c(c3)OCO4)no2)ccn1Cc1ccc(Cl)cc1
|
O=c1c(=O)n(Cc2nc(-c3ccc4c(c3)OCO4)no2)ccn1Cc1ccc(Cl)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.