| Name |
3-(5-((1R,2S)-2-(2,2-Difluoropropanamido)-1-(2,3-dihydrobenzo[b][1,4]dioxin-6-yl)propoxy)-1H-indazol-1-yl)-N-((S)-tetrahydrofuran-3-yl)benzamide
|
| Molecular Formula |
C32H32F2N4O6
|
| Molecular Weight |
606.6
|
| Smiles |
CC(NC(=O)C(C)(F)F)C(Oc1ccc2c(cnn2-c2cccc(C(=O)NC3CCOC3)c2)c1)c1ccc2c(c1)OCCO2
|
CC(NC(=O)C(C)(F)F)C(Oc1ccc2c(cnn2-c2cccc(C(=O)NC3CCOC3)c2)c1)c1ccc2c(c1)OCCO2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.