| Name |
4-chlorobenzyl 1-(4-fluorophenyl)-5-methyl-1H-1,2,3-triazole-4-carboxylate
|
| Molecular Formula |
C17H13ClFN3O2
|
| Molecular Weight |
345.8
|
| Smiles |
Cc1c(C(=O)OCc2ccc(Cl)cc2)nnn1-c1ccc(F)cc1
|
Cc1c(C(=O)OCc2ccc(Cl)cc2)nnn1-c1ccc(F)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.