| Name |
(3E)-3-{[(2-methoxy-5-methylphenyl)amino]methylene}-1-(4-methylbenzyl)-1H-2,1-benzothiazin-4(3H)-one 2,2-dioxide
|
| Molecular Formula |
C25H24N2O4S
|
| Molecular Weight |
448.5
|
| Smiles |
COc1ccc(C)cc1NC=C1C(=O)c2ccccc2N(Cc2ccc(C)cc2)S1(=O)=O
|
COc1ccc(C)cc1NC=C1C(=O)c2ccccc2N(Cc2ccc(C)cc2)S1(=O)=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.