| Name |
4-({(E)-[1-(3-methylbenzyl)-2,2-dioxido-4-oxo-1,4-dihydro-3H-2,1-benzothiazin-3-ylidene]methyl}amino)benzenesulfonamide
|
| Molecular Formula |
C23H21N3O5S2
|
| Molecular Weight |
483.6
|
| Smiles |
Cc1cccc(CN2c3ccccc3C(=O)C(=CNc3ccc(S(N)(=O)=O)cc3)S2(=O)=O)c1
|
Cc1cccc(CN2c3ccccc3C(=O)C(=CNc3ccc(S(N)(=O)=O)cc3)S2(=O)=O)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.