| Name |
2,5-dichloro-N-(6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3]thiazin-3-yl)benzamide
|
| Molecular Formula |
C12H10Cl2N4OS
|
| Molecular Weight |
329.2
|
| Smiles |
O=C(Nc1nnc2n1CCCS2)c1cc(Cl)ccc1Cl
|
O=C(Nc1nnc2n1CCCS2)c1cc(Cl)ccc1Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.