| Name |
5-methyl-2-(2,4,5-trimethoxyphenyl)-2,3,9,10,11,12-hexahydro-4H,8H-benzo[c]pyrano[2,3-f]chromene-4,8-dione
|
| Molecular Formula |
C26H26O7
|
| Molecular Weight |
450.5
|
| Smiles |
COc1cc(OC)c(C2CC(=O)c3c(C)cc4oc(=O)c5c(c4c3O2)CCCC5)cc1OC
|
COc1cc(OC)c(C2CC(=O)c3c(C)cc4oc(=O)c5c(c4c3O2)CCCC5)cc1OC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.