| Name |
8-(4-Chlorophenyl)-5-[(4-fluorophenyl)methyl]-1,3-dimethylpurino[8,9-c][1,2,4]triazole-2,4-dione
|
| Molecular Formula |
C21H16ClFN6O2
|
| Molecular Weight |
438.8
|
| Smiles |
Cn1c(=O)c2c(n(C)c1=O)n1c(-c3ccc(Cl)cc3)nnc1n2Cc1ccc(F)cc1
|
Cn1c(=O)c2c(n(C)c1=O)n1c(-c3ccc(Cl)cc3)nnc1n2Cc1ccc(F)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.