| Name |
3-(5-bromo-2-methoxyphenyl)-9-isopropyl-5-methyl-5H-[1,2,4]triazolo[4,3-e]purine-6,8(7H,9H)-dione
|
| Molecular Formula |
C17H17BrN6O3
|
| Molecular Weight |
433.3
|
| Smiles |
COc1ccc(Br)cc1-c1nnc2n(C(C)C)c3c(=O)[nH]c(=O)n(C)c3n12
|
COc1ccc(Br)cc1-c1nnc2n(C(C)C)c3c(=O)[nH]c(=O)n(C)c3n12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.