| Name |
3-chloro-N-(3,3,5-trimethyl-4-oxo-2,3,4,5-tetrahydrobenzo[b][1,4]oxazepin-8-yl)benzamide
|
| Molecular Formula |
C19H19ClN2O3
|
| Molecular Weight |
358.8
|
| Smiles |
CN1C(=O)C(C)(C)COc2cc(NC(=O)c3cccc(Cl)c3)ccc21
|
CN1C(=O)C(C)(C)COc2cc(NC(=O)c3cccc(Cl)c3)ccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.