| Name |
benzo[c][1,2,5]thiadiazol-5-yl(6,7-dimethoxy-3,4-dihydroisoquinolin-2(1H)-yl)methanone
|
| Molecular Formula |
C18H17N3O3S
|
| Molecular Weight |
355.4
|
| Smiles |
COc1cc2c(cc1OC)CN(C(=O)c1ccc3nsnc3c1)CC2
|
COc1cc2c(cc1OC)CN(C(=O)c1ccc3nsnc3c1)CC2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.