| Name |
1-(5-Ethyl-3,3-dimethyl-4-oxo-2,3,4,5-tetrahydrobenzo[b][1,4]oxazepin-8-yl)-3-(2-(trifluoromethyl)phenyl)urea
|
| Molecular Formula |
C21H22F3N3O3
|
| Molecular Weight |
421.4
|
| Smiles |
CCN1C(=O)C(C)(C)COc2cc(NC(=O)Nc3ccccc3C(F)(F)F)ccc21
|
CCN1C(=O)C(C)(C)COc2cc(NC(=O)Nc3ccccc3C(F)(F)F)ccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.