| Name |
D-Glucitol, 1,4:3,6-dianhydro-, 2-[2-(acetyloxy)benzoate] 5-(3-pyridinecarboxylate)
|
| Molecular Formula |
C21H19NO8
|
| Molecular Weight |
413.4
|
| Smiles |
CC(=O)Oc1ccccc1C(=O)OC1COC2C(OC(=O)c3cccnc3)COC12
|
CC(=O)Oc1ccccc1C(=O)OC1COC2C(OC(=O)c3cccnc3)COC12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.