| Name |
N-cyclohexyl-3-{5-[({[2-(3,4-dimethoxyphenyl)ethyl]carbamoyl}methyl)sulfanyl]-3-oxo-2H,3H-imidazo[1,2-c]quinazolin-2-yl}propanamide
|
| Molecular Formula |
C31H37N5O5S
|
| Molecular Weight |
591.7
|
| Smiles |
COc1ccc(CCNC(=O)CSC2=Nc3ccccc3C3=NC(CCC(=O)NC4CCCCC4)C(=O)N23)cc1OC
|
COc1ccc(CCNC(=O)CSC2=Nc3ccccc3C3=NC(CCC(=O)NC4CCCCC4)C(=O)N23)cc1OC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.