| Name |
N-(5-(2,4-dimethylthiazol-5-yl)-1,3,4-oxadiazol-2-yl)-2-(2,5-dioxopyrrolidin-1-yl)acetamide
|
| Molecular Formula |
C13H13N5O4S
|
| Molecular Weight |
335.34
|
| Smiles |
Cc1nc(C)c(-c2nnc(NC(=O)CN3C(=O)CCC3=O)o2)s1
|
Cc1nc(C)c(-c2nnc(NC(=O)CN3C(=O)CCC3=O)o2)s1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.