| Name |
methyl 3-(benzo[d]thiazol-2-yl)-2-(4-(methylthio)benzamido)-4,5-dihydrothieno[2,3-c]pyridine-6(7H)-carboxylate
|
| Molecular Formula |
C24H21N3O3S3
|
| Molecular Weight |
495.6
|
| Smiles |
COC(=O)N1CCc2c(sc(NC(=O)c3ccc(SC)cc3)c2-c2nc3ccccc3s2)C1
|
COC(=O)N1CCc2c(sc(NC(=O)c3ccc(SC)cc3)c2-c2nc3ccccc3s2)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.