| Name |
2-(3,5-Dichloro-phenoxy)-3,3,3-trifluoro-propylamine
|
| Molecular Formula |
C9H8Cl2F3NO
|
| Molecular Weight |
274.06
|
| Smiles |
NCC(Oc1cc(Cl)cc(Cl)c1)C(F)(F)F
|
NCC(Oc1cc(Cl)cc(Cl)c1)C(F)(F)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.