| Name |
N2-(5,6-Dichloro-1H-benzimidazol-2-yl)-N4-[3-[(diethylamino)methyl]-4-ethoxyphenyl]-5,6,7,8-tetrahydro-2,4-quinazolinediamine
|
| Molecular Formula |
C28H33Cl2N7O
|
| Molecular Weight |
554.5
|
| Smiles |
CCOc1ccc(Nc2nc(Nc3nc4cc(Cl)c(Cl)cc4[nH]3)nc3c2CCCC3)cc1CN(CC)CC
|
CCOc1ccc(Nc2nc(Nc3nc4cc(Cl)c(Cl)cc4[nH]3)nc3c2CCCC3)cc1CN(CC)CC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.