| Name |
2,2,2-trifluoroethyl N-(2-methyl-1,3-dioxo-2,3-dihydro-1H-isoindol-5-yl)carbamate
|
| Molecular Formula |
C12H9F3N2O4
|
| Molecular Weight |
302.21
|
| Smiles |
CN1C(=O)c2ccc(NC(=O)OCC(F)(F)F)cc2C1=O
|
CN1C(=O)c2ccc(NC(=O)OCC(F)(F)F)cc2C1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.