| Name |
7,8-dimethoxy-3-(3-(4-(2-methoxyphenyl)piperazin-1-yl)-3-oxopropyl)-3H-pyrimido[5,4-b]indol-4(5H)-one
|
| Molecular Formula |
C26H29N5O5
|
| Molecular Weight |
491.5
|
| Smiles |
COc1cc2[nH]c3c(=O)n(CCC(=O)N4CCN(c5ccccc5OC)CC4)cnc3c2cc1OC
|
COc1cc2[nH]c3c(=O)n(CCC(=O)N4CCN(c5ccccc5OC)CC4)cnc3c2cc1OC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.