| Name |
3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-1-{2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl}pyridin-2(1H)-one
|
| Molecular Formula |
C25H21ClFN5O3
|
| Molecular Weight |
493.9
|
| Smiles |
O=C(Cn1cccc(-c2nc(-c3ccc(Cl)cc3)no2)c1=O)N1CCN(c2ccc(F)cc2)CC1
|
O=C(Cn1cccc(-c2nc(-c3ccc(Cl)cc3)no2)c1=O)N1CCN(c2ccc(F)cc2)CC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.