| Name |
6-{3-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-3-oxopropyl}-2,3,5-trimethyl-7H-furo[3,2-g]chromen-7-one
|
| Molecular Formula |
C28H29ClN2O4
|
| Molecular Weight |
493.0
|
| Smiles |
Cc1ccc(Cl)cc1N1CCN(C(=O)CCc2c(C)c3cc4c(C)c(C)oc4cc3oc2=O)CC1
|
Cc1ccc(Cl)cc1N1CCN(C(=O)CCc2c(C)c3cc4c(C)c(C)oc4cc3oc2=O)CC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.