| Name |
N-{2-[(propylcarbamoyl)methyl]-2H,4H,6H-thieno[3,4-c]pyrazol-3-yl}adamantane-1-carboxamide
|
| Molecular Formula |
C21H30N4O2S
|
| Molecular Weight |
402.6
|
| Smiles |
CCCNC(=O)Cn1nc2c(c1NC(=O)C13CC4CC(CC(C4)C1)C3)CSC2
|
CCCNC(=O)Cn1nc2c(c1NC(=O)C13CC4CC(CC(C4)C1)C3)CSC2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.