| Name |
4-(3,4,5,6-tetrachloropyridine-2-carbonyl)-3,4-dihydro-2H-1,4-benzoxazine
|
| Molecular Formula |
C14H8Cl4N2O2
|
| Molecular Weight |
378.0
|
| Smiles |
O=C(c1nc(Cl)c(Cl)c(Cl)c1Cl)N1CCOc2ccccc21
|
O=C(c1nc(Cl)c(Cl)c(Cl)c1Cl)N1CCOc2ccccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.