| Name |
2-({1-[4-(butylamino)-6-(methylamino)-1,3,5-triazin-2-yl]-1H-1,2,4-triazol-3-yl}thio)acetamide
|
| Molecular Formula |
C12H19N9OS
|
| Molecular Weight |
337.41
|
| Smiles |
CCCCNc1nc(NC)nc(-n2cnc(SCC(N)=O)n2)n1
|
CCCCNc1nc(NC)nc(-n2cnc(SCC(N)=O)n2)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.