| Name |
N-[(2E)-5-cyclopropyl-1,3,4-thiadiazol-2(3H)-ylidene]-2-(3-methoxypropyl)-1,3-dioxo-2,3-dihydro-1H-isoindole-5-carboxamide
|
| Molecular Formula |
C18H18N4O4S
|
| Molecular Weight |
386.4
|
| Smiles |
COCCCN1C(=O)c2ccc(C(=O)Nc3nnc(C4CC4)s3)cc2C1=O
|
COCCCN1C(=O)c2ccc(C(=O)Nc3nnc(C4CC4)s3)cc2C1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.