| Name |
Methyl 5-({[5-(thiophen-2-yl)-1,3,4-oxadiazol-2-yl]sulfanyl}methyl)furan-2-carboxylate
|
| Molecular Formula |
C13H10N2O4S2
|
| Molecular Weight |
322.4
|
| Smiles |
COC(=O)c1ccc(CSc2nnc(-c3cccs3)o2)o1
|
COC(=O)c1ccc(CSc2nnc(-c3cccs3)o2)o1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.