| Name |
4-{[1-(3,4-difluorophenyl)-1H-1,2,3,4-tetrazol-5-yl]methyl}-N-[(thiophen-2-yl)methyl]piperazine-1-carboxamide
|
| Molecular Formula |
C18H19F2N7OS
|
| Molecular Weight |
419.5
|
| Smiles |
O=C(NCc1cccs1)N1CCN(Cc2nnnn2-c2ccc(F)c(F)c2)CC1
|
O=C(NCc1cccs1)N1CCN(Cc2nnnn2-c2ccc(F)c(F)c2)CC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.