| Name |
N'-(4-methoxy-1,3-benzothiazol-2-yl)-N,N-dimethylethane-1,2-diamine
|
| Molecular Formula |
C12H17N3OS
|
| Molecular Weight |
251.35
|
| Smiles |
COc1cccc2sc(NCCN(C)C)nc12
|
COc1cccc2sc(NCCN(C)C)nc12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.