| Name |
N-(2-{[3-(4-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy}ethyl)-3,5-dimethylbenzamide
|
| Molecular Formula |
C22H20FN5O2
|
| Molecular Weight |
405.4
|
| Smiles |
Cc1cc(C)cc(C(=O)NCCOc2ccc3nnc(-c4ccc(F)cc4)n3n2)c1
|
Cc1cc(C)cc(C(=O)NCCOc2ccc3nnc(-c4ccc(F)cc4)n3n2)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.