| Name |
5,5'-Dihydroxy-2,2'-diiodobiphenyl
|
| Molecular Formula |
C12H8I2O2
|
| Molecular Weight |
438.00
|
| Smiles |
Oc1ccc(I)c(-c2cc(O)ccc2I)c1
|
Oc1ccc(I)c(-c2cc(O)ccc2I)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.