| Name |
N-(4-chloro-2-methoxy-5-methylphenyl)-2-({3-ethyl-4-oxo-7-phenyl-3H,4H-thieno[3,2-d]pyrimidin-2-yl}sulfanyl)acetamide
|
| Molecular Formula |
C24H22ClN3O3S2
|
| Molecular Weight |
500.0
|
| Smiles |
CCn1c(SCC(=O)Nc2cc(C)c(Cl)cc2OC)nc2c(-c3ccccc3)csc2c1=O
|
CCn1c(SCC(=O)Nc2cc(C)c(Cl)cc2OC)nc2c(-c3ccccc3)csc2c1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.