| Name |
4-Chloro-6-methoxy-7-(2,2,2-trifluoroethoxy)quinazoline
|
| Molecular Formula |
C11H8ClF3N2O2
|
| Molecular Weight |
292.64
|
| Smiles |
COc1cc2c(Cl)ncnc2cc1OCC(F)(F)F
|
COc1cc2c(Cl)ncnc2cc1OCC(F)(F)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.