| Name |
2-[(4-aminophenyl)thio]-N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]acetamide
|
| Molecular Formula |
C17H13Cl2N3OS2
|
| Molecular Weight |
410.3
|
| Smiles |
Nc1ccc(SCC(=O)Nc2nc(-c3ccc(Cl)cc3Cl)cs2)cc1
|
Nc1ccc(SCC(=O)Nc2nc(-c3ccc(Cl)cc3Cl)cs2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.