| Name |
2H-anthra[1,2-d][1,3]oxazine-2,4,7,12(1H)-tetrone
|
| Molecular Formula |
C16H7NO5
|
| Molecular Weight |
293.23
|
| Smiles |
O=C1c2ccccc2C(=O)c2c1ccc1c(=O)oc(=O)[nH]c21
|
O=C1c2ccccc2C(=O)c2c1ccc1c(=O)oc(=O)[nH]c21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.