| Name |
1-(3,4-Dichlorophenyl)-3-[2-({3-phenyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl}oxy)ethyl]urea
|
| Molecular Formula |
C20H16Cl2N6O2
|
| Molecular Weight |
443.3
|
| Smiles |
O=C(NCCOc1ccc2nnc(-c3ccccc3)n2n1)Nc1ccc(Cl)c(Cl)c1
|
O=C(NCCOc1ccc2nnc(-c3ccccc3)n2n1)Nc1ccc(Cl)c(Cl)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.