| Name |
4-iodo-N-((6-phenyl-2,3-dihydroimidazo[2,1-b]thiazol-5-yl)methyl)benzamide
|
| Molecular Formula |
C19H16IN3OS
|
| Molecular Weight |
461.3
|
| Smiles |
O=C(NCc1c(-c2ccccc2)nc2n1CCS2)c1ccc(I)cc1
|
O=C(NCc1c(-c2ccccc2)nc2n1CCS2)c1ccc(I)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.